CAS 6014-30-8 appears in our catalog under these names: Methyldopate, 97%, Methyldopate, Methyldopate, 98.01%, Methyldopate, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 1mg, 10mg, 100 mg, 50 mg, 10 mg.
Ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (CAS 6014-30-8) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate. InChIKey: SVEBYYWCXTVYCR-LBPRGKRZSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| InChIKey | SVEBYYWCXTVYCR-LBPRGKRZSA-N |
| SMILES | CCOC(=O)[C@](C)(CC1=CC(=C(C=C1)O)O)N |
Computed by PubChem (NCBI)