CAS 6017-21-6 appears in our catalog under these names: Benzeneazomalononitrile, BenzeneazoMalononitrile/ 97.6% (existing batch purity), Benzeneazomalononitrile 96%, 2-(Phenylazo)malononitrile, 96%, 96%. Offered by: TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 10g, 1g, 250g, 5mg, 10mg, 25mg, 50mg, 100mg.
2-phenyldiazenylpropanedinitrile (CAS 6017-21-6) is a chemical compound with the molecular formula C9H6N4 and a molecular weight of 170.17 g/mol. IUPAC name: 2-phenyldiazenylpropanedinitrile. InChIKey: KLMBASWITNCMTF-UHFFFAOYSA-N.
| Molecular formula | C9H6N4 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 2-phenyldiazenylpropanedinitrile |
| InChIKey | KLMBASWITNCMTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC(C#N)C#N |
Computed by PubChem (NCBI)