CAS 6021-32-5 appears in our catalog under these names: Methyl 4-bromo-2,3-dimethylbenzoate, 95%, Methyl 4–bromo–2,3–dimethylbenzoate, Methyl 4-bromo-2,3-dimethylbenzoate 95%, Methyl 4-bromo-2,3-dimethylbenzoate, 98%, 98%, METHYL 4-BROMO-2,3-DIMETHYLBENZOATE, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
Methyl 4-bromo-2,3-dimethylbenzoate (CAS 6021-32-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 4-bromo-2,3-dimethylbenzoate. InChIKey: OBGPZONEGQIWOS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 4-bromo-2,3-dimethylbenzoate |
| InChIKey | OBGPZONEGQIWOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Br)C(=O)OC |
Computed by PubChem (NCBI)