CAS 60260-49-3 is the registry number for N-Phenylsulfamoyl chloride. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
N-phenylsulfamoyl chloride (CAS 60260-49-3) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: N-phenylsulfamoyl chloride. InChIKey: SGSHEKZPIDTZJQ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | N-phenylsulfamoyl chloride |
| InChIKey | SGSHEKZPIDTZJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)Cl |
Computed by PubChem (NCBI)