CAS 6030-83-7 appears in our catalog under these names: Estratetraenone Methyl Ether, Estratetraenol Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(9S,13S,14S)-3-methoxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 6030-83-7) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: (9S,13S,14S)-3-methoxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: DOLVDOAPSINHRR-AYBZRNKSSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | (9S,13S,14S)-3-methoxy-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | DOLVDOAPSINHRR-AYBZRNKSSA-N |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=C4)OC)[C@@H]1CCC2=O |
Computed by PubChem (NCBI)