CAS 2005-09-6 appears in our catalog under these names: Propofol Benzoate, Propofol Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
[2,6-di(propan-2-yl)phenyl] benzoate (CAS 2005-09-6) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl] benzoate. InChIKey: FWWZVJVOMUKVKV-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl] benzoate |
| InChIKey | FWWZVJVOMUKVKV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)