Products 255836-57-8
CAS 255836-57-8 is the registry number for α-Methoxy-α-(4-tert-butylphenyl)acetophenone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(4-tert-butylphenyl)-2-methoxy-1-phenylethanone (CAS 255836-57-8) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2-methoxy-1-phenylethanone. InChIKey: SGPKZRJAWYZOOY-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2-methoxy-1-phenylethanone |
| InChIKey | SGPKZRJAWYZOOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)