CAS 1796933-62-4 is the registry number for Palonosetron Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-propylbenzene-1,3-diol (CAS 1796933-62-4) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: 2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-propylbenzene-1,3-diol. InChIKey: COURSARJQZMTEZ-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-propylbenzene-1,3-diol |
| InChIKey | COURSARJQZMTEZ-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=C(C(=C1)O)C2=C(C=CC(=C2)C)C(=C)C)O |
Computed by PubChem (NCBI)