CAS 1504-38-7 appears in our catalog under these names: 2,4,6-Trimethylphenyl 2,4,6-trimethylbenzoate, 95%, Mesityl 2,4,6-trimethylbenzoate, 98%, 2,4,6–Trimethylphenyl 2,4,6–trimethyl benzoate, 2,4,6-Trimethylphenyl 2,4,6-trimethylbenzoate, 95%, 95%, BENZOIC ACID, 2,4,6-TRIMETHYL-, 2,4,6-TRIMETHYLPHENYL ESTER, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2,4,6-trimethylphenyl) 2,4,6-trimethylbenzoate (CAS 1504-38-7) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: (2,4,6-trimethylphenyl) 2,4,6-trimethylbenzoate. InChIKey: FAWKUOSTOPFSTA-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | (2,4,6-trimethylphenyl) 2,4,6-trimethylbenzoate |
| InChIKey | FAWKUOSTOPFSTA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)OC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)