CAS 604-83-1 is the registry number for 9,10-Dimethylphenanthrene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9,10-dimethylphenanthrene (CAS 604-83-1) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 9,10-dimethylphenanthrene. InChIKey: JUEORGSHIXFSSI-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 9,10-dimethylphenanthrene |
| InChIKey | JUEORGSHIXFSSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C3=CC=CC=C13)C |
Computed by PubChem (NCBI)