Products 60423-91-8

CAS 60423-91-8 is the registry number for 3-(4-Cyanophenyl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(4-cyanophenyl)-2-methylpropanoic acid (CAS 60423-91-8) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3-(4-cyanophenyl)-2-methylpropanoic acid. InChIKey: PODRKIBRUMPBFE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC name3-(4-cyanophenyl)-2-methylpropanoic acid
InChIKeyPODRKIBRUMPBFE-UHFFFAOYSA-N
SMILESCC(CC1=CC=C(C=C1)C#N)C(=O)O

Computed by PubChem (NCBI)