CAS 60468-54-4 appears in our catalog under these names: 2–Methyl–3–nitrobenzyl Chloride, 2-Methyl-3-nitrobenzyl Chloride, >98.0%(GC), 2-Methyl-3-nitrobenzyl chloride, 97%, 2-Methyl-3-nitrobenzyl chloride 98%, 2-Methyl-3-nitrobenzyl chloride, 98%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
1-(chloromethyl)-2-methyl-3-nitrobenzene (CAS 60468-54-4) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 1-(chloromethyl)-2-methyl-3-nitrobenzene. InChIKey: XZNDXQGZPOZITR-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 1-(chloromethyl)-2-methyl-3-nitrobenzene |
| InChIKey | XZNDXQGZPOZITR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)