CAS 604762-23-4 is the registry number for 3-(Prop-2-enylamino)-5-methyl-2,4-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
4-methyl-2-(prop-2-enylamino)-1,3-thiazole-5-carboxylic acid (CAS 604762-23-4) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 4-methyl-2-(prop-2-enylamino)-1,3-thiazole-5-carboxylic acid. InChIKey: JQNBZZJKQDHVBP-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 4-methyl-2-(prop-2-enylamino)-1,3-thiazole-5-carboxylic acid |
| InChIKey | JQNBZZJKQDHVBP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NCC=C)C(=O)O |
Computed by PubChem (NCBI)