CAS 604811-49-6 is the registry number for NDM-1 inhibitor-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one (CAS 604811-49-6) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: (2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one. InChIKey: OEPXUPYNKGGCKD-MLPAPPSSSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | (2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| InChIKey | OEPXUPYNKGGCKD-MLPAPPSSSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C\2/C(=O)C3=C(O2)C(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)