Products 60546-87-4

CAS 60546-87-4 is the registry number for Ethyl N-(1-Methyl-2-phenylethyl)glycine Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(1-phenylpropan-2-ylamino)acetate (CAS 60546-87-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: ethyl 2-(1-phenylpropan-2-ylamino)acetate. InChIKey: FMQXBLNXUDYKRW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO2
Molecular weight221.29 g/mol
IUPAC nameethyl 2-(1-phenylpropan-2-ylamino)acetate
InChIKeyFMQXBLNXUDYKRW-UHFFFAOYSA-N
SMILESCCOC(=O)CNC(C)CC1=CC=CC=C1

Computed by PubChem (NCBI)