CAS 60624-38-6 is the registry number for 2-((2,2-dinitrilovinyl)amino)benzamide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-(2,2-dicyanoethenylamino)benzamide (CAS 60624-38-6) is a chemical compound with the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. IUPAC name: 2-(2,2-dicyanoethenylamino)benzamide. InChIKey: NOJLELUSFNKMCY-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 2-(2,2-dicyanoethenylamino)benzamide |
| InChIKey | NOJLELUSFNKMCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NC=C(C#N)C#N |
Computed by PubChem (NCBI)