CAS 60894-49-7 is the registry number for Z-Ala-beta-naphthyl ester. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
Naphthalen-2-yl (2S)-2-(phenylmethoxycarbonylamino)propanoate (CAS 60894-49-7) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: naphthalen-2-yl (2S)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: VFRJBGYAMMSYFN-HNNXBMFYSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | naphthalen-2-yl (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | VFRJBGYAMMSYFN-HNNXBMFYSA-N |
| SMILES | C[C@@H](C(=O)OC1=CC2=CC=CC=C2C=C1)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)