Products 60902-27-4
CAS 60902-27-4 appears in our catalog under these names: N-(4-Ethoxyphenyl)acetamide-2,2,2-d3, Phenacetin-d3, Phenacetin-d3, >95% (HPLC). Offered by: MedChemExpress, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 100 mg, 10 mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2,2-trideuterio-N-(4-ethoxyphenyl)acetamide (CAS 60902-27-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 182.23 g/mol. IUPAC name: 2,2,2-trideuterio-N-(4-ethoxyphenyl)acetamide. InChIKey: CPJSUEIXXCENMM-BMSJAHLVSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 182.23 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(4-ethoxyphenyl)acetamide |
| InChIKey | CPJSUEIXXCENMM-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC=C(C=C1)OCC |
Computed by PubChem (NCBI)