Products 72156-72-0
CAS 72156-72-0 is the registry number for Phenacetin-13C, 99.9%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg.
N-(4-(113C)ethoxyphenyl)acetamide (CAS 72156-72-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 180.21 g/mol. IUPAC name: N-(4-(113C)ethoxyphenyl)acetamide. InChIKey: CPJSUEIXXCENMM-LBPDFUHNSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 180.21 g/mol |
| IUPAC name | N-(4-(113C)ethoxyphenyl)acetamide |
| InChIKey | CPJSUEIXXCENMM-LBPDFUHNSA-N |
| SMILES | C[13CH2]OC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)