Products 69323-74-6
CAS 69323-74-6 appears in our catalog under these names: Phenacetin-d5, Phenacetin-d5, >95% (HPLC), Phenacetin–d5, Phenacetin-d5, 99.51%. Offered by: Hubei YoungXin, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg, 1 mg.
N-[4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]acetamide (CAS 69323-74-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 184.25 g/mol. IUPAC name: N-[4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]acetamide. InChIKey: CPJSUEIXXCENMM-WNWXXORZSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 184.25 g/mol |
| IUPAC name | N-[4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]acetamide |
| InChIKey | CPJSUEIXXCENMM-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)