Products 60924-65-4
CAS 60924-65-4 is the registry number for 2-Hydroxy-2-(2-methylpropyl)butanedioic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-2-(2-methylpropyl)butanedioic acid (CAS 60924-65-4) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: 2-hydroxy-2-(2-methylpropyl)butanedioic acid. InChIKey: AOJRRQNPQBDATA-UHFFFAOYSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2-hydroxy-2-(2-methylpropyl)butanedioic acid |
| InChIKey | AOJRRQNPQBDATA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)