CAS 60956-26-5 appears in our catalog under these names: 4-Bromo-2-nitrotoluene, 99% , 4-Bromo-2-nitrotoluene, 4-Bromo-2-nitrotoluene, >98.0%(GC), 4-Bromo-2-nitrotoluene 98%, 4-Bromo-2-nitrotoluene 97%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 100g, 250g, 25g, 500g, 1000g, 2000g, 10G.
4-bromo-1-methyl-2-nitrobenzene (CAS 60956-26-5) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 4-bromo-1-methyl-2-nitrobenzene. InChIKey: KZNXALJXBRSMFL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 4-bromo-1-methyl-2-nitrobenzene |
| InChIKey | KZNXALJXBRSMFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)