Products 609807-25-2
CAS 609807-25-2 appears in our catalog under these names: 3–Fluoro–5–methoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Fluoro-5-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Fluoro-5-methoxyphenylboronic acid 98%, 3-Fluoro-5-methoxyphenylboronic acid, 98%, 98%, 3-Fluoro-5-methoxyphenylboronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 100g.
(3-fluoro-5-methoxyphenyl)boronic acid (CAS 609807-25-2) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: (3-fluoro-5-methoxyphenyl)boronic acid. InChIKey: MQFKLCWETPKBCH-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | (3-fluoro-5-methoxyphenyl)boronic acid |
| InChIKey | MQFKLCWETPKBCH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-fluoro-5-methoxyphenyl)boronic acid, 3-Fluoro-5-methoxyphenylboronic acid, 3-fluoro-5-methoxybenzeneboronic acid, (3-fluoro-5-methoxy-phenyl)boronic Acid, 3-Fluoro-5-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Fluoro-5-methoxyphenylboronicacid, MQFKLCWETPKBCH-UHFFFAOYSA-N, 3-fluoro-5-methoxy phenylboronic acid, 3-Fluoro-5-methoxyphenyl boronic acid, B-(3-Fluoro-5-methoxyphenyl)boronic acid