CAS 610260-63-4 is the registry number for 4-[(3,5-Dimethylisoxazol-4-yl)methoxy]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzaldehyde (CAS 610260-63-4) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzaldehyde. InChIKey: LMLHECCOGOQRMS-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzaldehyde |
| InChIKey | LMLHECCOGOQRMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)