Products 61042-30-6
CAS 61042-30-6 is the registry number for Ethyl 2,5-dimethoxy-4-methyl-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(2,5-dimethoxy-4-methylphenyl)-2-oxoacetate (CAS 61042-30-6) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: ethyl 2-(2,5-dimethoxy-4-methylphenyl)-2-oxoacetate. InChIKey: TZDAIKQXNXRBSH-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | ethyl 2-(2,5-dimethoxy-4-methylphenyl)-2-oxoacetate |
| InChIKey | TZDAIKQXNXRBSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C(=C1)OC)C)OC |
Computed by PubChem (NCBI)