CAS 611-92-7 appears in our catalog under these names: 1,3-Dimethyl-1,3-Diphenylurea , Centralite II, >95% (HPLC), 1，3–Dimethyl–1，3–diphenylurea, 1,3-Dimethyl-1,3-diphenylurea, 1,3-Dimethyl-1,3-diphenylurea 95%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1g, 250mg, 25g, 5g, 0,5g, 10g, 100g.
1,3-dimethyl-1,3-diphenylurea (CAS 611-92-7) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 1,3-dimethyl-1,3-diphenylurea. InChIKey: ADCBKYIHQQCFHE-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,3-dimethyl-1,3-diphenylurea |
| InChIKey | ADCBKYIHQQCFHE-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)N(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)