Products 611240-68-7
CAS 611240-68-7 appears in our catalog under these names: 8-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyrazine, 98%, 98%, 8-CHLORO-2-(TRIFLUOROMETHYL)IMIDAZO[1,2-A]PYRAZINE, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
8-chloro-2-(trifluoromethyl)imidazo[1,2-a]pyrazine (CAS 611240-68-7) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 8-chloro-2-(trifluoromethyl)imidazo[1,2-a]pyrazine. InChIKey: KQJHKSUQZLPAIG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 8-chloro-2-(trifluoromethyl)imidazo[1,2-a]pyrazine |
| InChIKey | KQJHKSUQZLPAIG-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)