CAS 61152-01-0 appears in our catalog under these names: 2-(2-Fluorophenyl)-5-methyloxazole-4-carboxylic acid, 97%, 2-(2-Fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 61152-01-0) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 2-(2-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: ZNRMZNOYTOYDBR-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZNRMZNOYTOYDBR-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)