CAS 61152-02-1 is the registry number for 2-(3-Fluorophenyl)-5-methyloxazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 61152-02-1) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: 2-(3-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: ZXTWCHFKLOJCKT-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZXTWCHFKLOJCKT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)