CAS 612527-78-3 is the registry number for 5-Bromo-N-methyl-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-bromo-N-methyl-1,3-benzothiazol-2-amine (CAS 612527-78-3) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 5-bromo-N-methyl-1,3-benzothiazol-2-amine. InChIKey: RHEIKUIELFJNSE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 5-bromo-N-methyl-1,3-benzothiazol-2-amine |
| InChIKey | RHEIKUIELFJNSE-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)