CAS 73901-11-8 is the registry number for 6-Bromo-3-methyl-1,3-benzothiazol-2(3h)-imine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.
6-bromo-3-methyl-1,3-benzothiazol-2-imine (CAS 73901-11-8) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 6-bromo-3-methyl-1,3-benzothiazol-2-imine. InChIKey: KOKMNRMHKISQCT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 6-bromo-3-methyl-1,3-benzothiazol-2-imine |
| InChIKey | KOKMNRMHKISQCT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)SC1=N |
Computed by PubChem (NCBI)