CAS 76996-16-2 appears in our catalog under these names: 2–Amino–4–bromo–6–methylbenzothiazole, 4-Bromo-6-methyl-1,3-benzothiazol-2-amine, 97%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 10g, 5g.
4-bromo-6-methyl-1,3-benzothiazol-2-amine (CAS 76996-16-2) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 4-bromo-6-methyl-1,3-benzothiazol-2-amine. InChIKey: PBKFYZMSNJCLOA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 4-bromo-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | PBKFYZMSNJCLOA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)N=C(S2)N |
Computed by PubChem (NCBI)