CAS 61889-26-7 is the registry number for 3-Bromo-4,6-dimethyl-isothiazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-bromo-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridine (CAS 61889-26-7) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 3-bromo-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridine. InChIKey: GQVKRDRDFJTFEZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 3-bromo-4,6-dimethyl-[1,2]thiazolo[5,4-b]pyridine |
| InChIKey | GQVKRDRDFJTFEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=NS2)Br)C |
Computed by PubChem (NCBI)