CAS 944887-82-5 appears in our catalog under these names: 5-Bromo-6-methyl-1,3-benzothiazol-2-amine, 98%, 5-Bromo-6-methylbenzo[d]thiazol-2-amine 95%, 5-Bromo-6-methylbenzo[d]thiazol-2-amine, 95%, 95%, 5-bromo-6-methyl-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g.
5-bromo-6-methyl-1,3-benzothiazol-2-amine (CAS 944887-82-5) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 5-bromo-6-methyl-1,3-benzothiazol-2-amine. InChIKey: LHFKOJQPISWLAY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 5-bromo-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | LHFKOJQPISWLAY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)N=C(S2)N |
Computed by PubChem (NCBI)