Products 612530-69-5
CAS 612530-69-5 is the registry number for 5-Benzyl-1,2,5-thiadiazolidin-3-one 1,1-dioxide, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-3-one (CAS 612530-69-5) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-3-one. InChIKey: UNFJLRCZNPDZMZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| InChIKey | UNFJLRCZNPDZMZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NS(=O)(=O)N1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)