CAS 613-26-3 is the registry number for 2,6-Dimethylanthracene. Offered by: TRC. Available pack sizes: 25mg, 50mg.
2,6-dimethylanthracene (CAS 613-26-3) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 2,6-dimethylanthracene. InChIKey: AYRABHFHMLXKBT-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2,6-dimethylanthracene |
| InChIKey | AYRABHFHMLXKBT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(C=C(C=C3)C)C=C2C=C1 |
Computed by PubChem (NCBI)