Products 613256-52-3
CAS 613256-52-3 appears in our catalog under these names: Captopril Impurity 3, ((R)-3-Hydroxy-2-methylpropanoyl)-L-proline, 98%, Captopril Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-[(2R)-3-hydroxy-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 613256-52-3) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (2S)-1-[(2R)-3-hydroxy-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: OTGZFIBHHGZWEJ-RQJHMYQMSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2S)-1-[(2R)-3-hydroxy-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | OTGZFIBHHGZWEJ-RQJHMYQMSA-N |
| SMILES | C[C@H](CO)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)