Products 613670-77-2

CAS 613670-77-2 is the registry number for Faropenem Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid (CAS 613670-77-2) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid. InChIKey: XZUWAHCIQCKWFP-RXMQYKEDSA-N.

Identity
Molecular formulaC8H9NO3S
Molecular weight199.23 g/mol
IUPAC name5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid
InChIKeyXZUWAHCIQCKWFP-RXMQYKEDSA-N
SMILESC1C[C@@H](OC1)C2=C(N=CS2)C(=O)O

Computed by PubChem (NCBI)