CAS 613670-77-2 is the registry number for Faropenem Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid (CAS 613670-77-2) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid. InChIKey: XZUWAHCIQCKWFP-RXMQYKEDSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | XZUWAHCIQCKWFP-RXMQYKEDSA-N |
| SMILES | C1C[C@@H](OC1)C2=C(N=CS2)C(=O)O |
Computed by PubChem (NCBI)