CAS 61502-90-7 appears in our catalog under these names: 4-Biphenylacetaldehyde, 2-((1,1'-Biphenyl)-4-yl)acetaldehyde, 97%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 1g.
2-(4-phenylphenyl)acetaldehyde (CAS 61502-90-7) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 2-(4-phenylphenyl)acetaldehyde. InChIKey: OIDMZCMVYZLDLI-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 2-(4-phenylphenyl)acetaldehyde |
| InChIKey | OIDMZCMVYZLDLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC=O |
Computed by PubChem (NCBI)