CAS 61568-51-2 is the registry number for 2-(4-Bromophenyl)-1,3-dioxane, 97%. Offered by: AmBeed. Available pack sizes: 25g, 1g.
2-(4-bromophenyl)-1,3-dioxane (CAS 61568-51-2) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-dioxane. InChIKey: HMXWGZTXWOBGOC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-dioxane |
| InChIKey | HMXWGZTXWOBGOC-UHFFFAOYSA-N |
| SMILES | C1COC(OC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)