CAS 61589-33-1 is the registry number for indolinyl(phenylamino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
N-phenyl-2,3-dihydroindole-1-carbothioamide (CAS 61589-33-1) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: N-phenyl-2,3-dihydroindole-1-carbothioamide. InChIKey: VVFHKNPLMUVKSV-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | N-phenyl-2,3-dihydroindole-1-carbothioamide |
| InChIKey | VVFHKNPLMUVKSV-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=S)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)