CAS 61592-45-8 appears in our catalog under these names: N-Methylbentazon, Bentazone-methyl, Bentazone-methyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 500mg, 50mg, 1x5ml, 1x50mg.
1-methyl-2,2-dioxo-3-propan-2-yl-2lambda6,1,3-benzothiadiazin-4-one (CAS 61592-45-8) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 1-methyl-2,2-dioxo-3-propan-2-yl-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: XFTQFXBQDVWOCY-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 1-methyl-2,2-dioxo-3-propan-2-yl-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | XFTQFXBQDVWOCY-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CC=CC=C2N(S1(=O)=O)C |
Computed by PubChem (NCBI)