CAS 61676-87-7 appears in our catalog under these names: Cymiazole, Cymiazole 10 µg/mL in Acetonitrile, Cymiazole, Concentration: 100 µg/ml Solvent: Acetonitrile, Cymiazole (Standard). Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 250mg, 100mg, 10ml, 25mg, 10mg, 50mg, 1x5ml, 1x100mg.
N-(2,4-dimethylphenyl)-3-methyl-1,3-thiazol-2-imine (CAS 61676-87-7) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-3-methyl-1,3-thiazol-2-imine. InChIKey: YUAUPYJCVKNAEC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-3-methyl-1,3-thiazol-2-imine |
| InChIKey | YUAUPYJCVKNAEC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=C2N(C=CS2)C)C |
Computed by PubChem (NCBI)