CAS 61699-62-5 appears in our catalog under these names: 3,4–Bis(1–methylethoxy)–3–cyclobutene–1,2–dione, 3,4-Diisopropoxy-3-cyclobutene-1,2-dione, >98.0%(GC), Diisopropyl squarate, 98%, 98%, 3,4-Diisopropoxy-3-cyclobutene-1,2-dione, 98%, 3,4-Diisopropoxycyclobut-3-ene-1,2-dione, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
3,4-di(propan-2-yloxy)cyclobut-3-ene-1,2-dione (CAS 61699-62-5) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: 3,4-di(propan-2-yloxy)cyclobut-3-ene-1,2-dione. InChIKey: KCZPGGVPQXQGEJ-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3,4-di(propan-2-yloxy)cyclobut-3-ene-1,2-dione |
| InChIKey | KCZPGGVPQXQGEJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=O)C1=O)OC(C)C |
Computed by PubChem (NCBI)