CAS 61834-95-5 appears in our catalog under these names: Anagrelide 7-Dechloro Impurity, Dechloro anagrelide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 1mg, 10mg.
6-chloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (CAS 61834-95-5) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 6-chloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one. InChIKey: RFUZAPDLTCFPQE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 6-chloro-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| InChIKey | RFUZAPDLTCFPQE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Cl)N=C3N1CC(=O)N3 |
Computed by PubChem (NCBI)