Products 61921-33-3
CAS 61921-33-3 appears in our catalog under these names: (2E)-3-(4-Nitrophenyl)acryloyl chloride, (2E)-3-(4-Nitrophenyl)acryloyl chloride, 95%, (2E)-3-(4-nitrophenyl)acryloyl chloride, ≥95%, TRANS-4-NITROCINNAMOYL CHLORIDE, 97%, trans-4-Nitrocinnamoyl chloride. Offered by: Chemat Brand, Combi-blocks, Fluorochem, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1g, 250mg, 5g, 5 g, 1 g.
(E)-3-(4-nitrophenyl)prop-2-enoyl chloride (CAS 61921-33-3) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: (E)-3-(4-nitrophenyl)prop-2-enoyl chloride. InChIKey: RUPXNPWALFDXJD-ZZXKWVIFSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | (E)-3-(4-nitrophenyl)prop-2-enoyl chloride |
| InChIKey | RUPXNPWALFDXJD-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
trans-4-Nitrocinnamoyl chloride, (2E)-3-(4-nitrophenyl)acryloyl chloride, (E)-3-(4-Nitrophenyl)acryloyl chloride, (E)-3-(4-nitrophenyl)prop-2-enoyl chloride, (2E)-3-(4-nitrophenyl)prop-2-enoyl chloride, 2-Propenoyl chloride, 3-(4-nitrophenyl)-, p-nitrocinnamoyl chloride, orb1690412, trans-4-Nitrocinnamoyl chloride, 97%, (E)-3-(4-Nitrophenyl)acryloylchloride