CAS 14529-12-5 appears in our catalog under these names: 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione, 95%, 6-Chloro-1-methyl-1H-benzo(d)(1,3)oxazine-2,4-dione, 97%, 6–chloro–1–methyl–2H–3,1–benzoxazine–2,4(1H)–dione, 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione, 97%, 97%, 6-Chloro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg, 2.5g.
6-chloro-1-methyl-3,1-benzoxazine-2,4-dione (CAS 14529-12-5) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione. InChIKey: FKTQNWWDMJDNHA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione |
| InChIKey | FKTQNWWDMJDNHA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=O)OC1=O |
Computed by PubChem (NCBI)