CAS 2115748-12-2 is the registry number for Methyl 7-chlorobenzo[c]isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-chloro-2,1-benzoxazole-3-carboxylate (CAS 2115748-12-2) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 7-chloro-2,1-benzoxazole-3-carboxylate. InChIKey: BDHADJWJLKRWPZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 7-chloro-2,1-benzoxazole-3-carboxylate |
| InChIKey | BDHADJWJLKRWPZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=C(C2=NO1)Cl |
Computed by PubChem (NCBI)