CAS 61941-58-0 is the registry number for Amfenac Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 2-(2-amino-3-benzoylphenyl)acetate (CAS 61941-58-0) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: methyl 2-(2-amino-3-benzoylphenyl)acetate. InChIKey: XSIAJRFXWYEOJL-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | methyl 2-(2-amino-3-benzoylphenyl)acetate |
| InChIKey | XSIAJRFXWYEOJL-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC=C1)C(=O)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)