Products 61948-67-2
CAS 61948-67-2 appears in our catalog under these names: 2–Amino–5–ethoxy–4–methoxybenzoic acid, 2-Amino-5-ethoxy-4-methoxybenzoic acid, 95%, 2-Amino-5-ethoxy-4-methoxybenzoic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-amino-5-ethoxy-4-methoxybenzoic acid (CAS 61948-67-2) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 2-amino-5-ethoxy-4-methoxybenzoic acid. InChIKey: LMLMBWMYHXXDAN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 2-amino-5-ethoxy-4-methoxybenzoic acid |
| InChIKey | LMLMBWMYHXXDAN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C(=O)O)N)OC |
Computed by PubChem (NCBI)